C14H22ClN — CID 171211996
(R)-cyclobutyl-(3-propan-2-ylphenyl)methanamine;hydrochloride (PubChem CID 171211996) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is (R)-cyclobutyl-(3-propan-2-ylphenyl)methanamine;hydrochloride.
| Compound Name | (R)-cyclobutyl-(3-propan-2-ylphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171211996 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | (R)-cyclobutyl-(3-propan-2-ylphenyl)methanamine;hydrochloride |
| SMILES | CC(C)c1cccc([C@H](N)C2CCC2)c1.Cl |
| InChI | InChI=1S/C14H21N.ClH/c1-10(2)12-7-4-8-13(9-12)14(15)11-5-3-6-11;/h4,7-11,14H,3,5-6,15H2,1-2H3;1H/t14-;/m1./s1 |
| InChIKey | RICOUOUNYAGAIQ-PFEQFJNWSA-N |
| XLogP | 4.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |