C29H52O3SSi — CID 102047495
S-[2,4,6-tri(propan-2-yl)phenyl] (2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,5-dimethylhexanethioate (PubChem CID 102047495) has the molecular formula C29H52O3SSi and a molecular weight of 508.89 g/mol. Its IUPAC name is S-[2,4,6-tri(propan-2-yl)phenyl] (2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,5-dimethylhexanethioate.
| Compound Name | S-[2,4,6-tri(propan-2-yl)phenyl] (2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,5-dimethylhexanethioate |
|---|---|
| PubChem CID | 102047495 |
| Molecular Formula | C29H52O3SSi |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | S-[2,4,6-tri(propan-2-yl)phenyl] (2R,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,5-dimethylhexanethioate |
| SMILES | CC(C)c1cc(C(C)C)c(SC(=O)[C@H](C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C29H52O3SSi/c1-17(2)22-15-23(18(3)4)27(24(16-22)19(5)6)33-28(31)21(9)25(30)26(20(7)8)32-34(13,14)29(10,11)12/h15-21,25-26,30H,1-14H3/t21-,25-,26+/m1/s1 |
| InChIKey | PYYHYPQTNMPMPM-QGDZQMKYSA-N |
| XLogP | 8.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|