C37H55NO4SSi — CID 139840623
N-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1,1-diphenylbutan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 139840623) has the molecular formula C37H55NO4SSi and a molecular weight of 638.00 g/mol. Its IUPAC name is N-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1,1-diphenylbutan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1,1-diphenylbutan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 139840623 |
| Molecular Formula | C37H55NO4SSi |
| Molecular Weight | 638.00 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | N-[3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-1,1-diphenylbutan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)NC(C(C)O[Si](C)(C)C(C)(C)C)C(O)(c2ccccc2)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C37H55NO4SSi/c1-25(2)29-23-32(26(3)4)34(33(24-29)27(5)6)43(40,41)38-35(28(7)42-44(11,12)36(8,9)10)37(39,30-19-15-13-16-20-30)31-21-17-14-18-22-31/h13-28,35,38-39H,1-12H3 |
| InChIKey | ZZAWKQQXGJRNSA-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.00 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|