C25H30N2O6SSi — CID 139840618
N-(1-hydroxy-1,1-diphenyl-3-trimethylsilyloxybutan-2-yl)-4-nitrobenzenesulfonamide (PubChem CID 139840618) has the molecular formula C25H30N2O6SSi and a molecular weight of 514.68 g/mol. Its IUPAC name is N-(1-hydroxy-1,1-diphenyl-3-trimethylsilyloxybutan-2-yl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(1-hydroxy-1,1-diphenyl-3-trimethylsilyloxybutan-2-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 139840618 |
| Molecular Formula | C25H30N2O6SSi |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | N-(1-hydroxy-1,1-diphenyl-3-trimethylsilyloxybutan-2-yl)-4-nitrobenzenesulfonamide |
| SMILES | CC(O[Si](C)(C)C)C(NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O6SSi/c1-19(33-35(2,3)4)24(26-34(31,32)23-17-15-22(16-18-23)27(29)30)25(28,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-19,24,26,28H,1-4H3 |
| InChIKey | IMMIBPYBQBPJJC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|