C42H43NO4SSi — CID 139840624
N-[3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-1,1-diphenylbutan-2-yl]naphthalene-1-sulfonamide (PubChem CID 139840624) has the molecular formula C42H43NO4SSi and a molecular weight of 685.96 g/mol. Its IUPAC name is N-[3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-1,1-diphenylbutan-2-yl]naphthalene-1-sulfonamide.
| Compound Name | N-[3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-1,1-diphenylbutan-2-yl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 139840624 |
| Molecular Formula | C42H43NO4SSi |
| Molecular Weight | 685.96 g/mol |
| Exact Mass | 685.27 |
| IUPAC Name | N-[3-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-1,1-diphenylbutan-2-yl]naphthalene-1-sulfonamide |
| SMILES | CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(NS(=O)(=O)c1cccc2ccccc12)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H43NO4SSi/c1-32(47-49(41(2,3)4,36-26-13-7-14-27-36)37-28-15-8-16-29-37)40(42(44,34-22-9-5-10-23-34)35-24-11-6-12-25-35)43-48(45,46)39-31-19-21-33-20-17-18-30-38(33)39/h5-32,40,43-44H,1-4H3 |
| InChIKey | KNWXXOWQKNPVKS-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.96 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|