C25H29Cl2NO4SSi — CID 139840631
2,5-dichloro-N-(1-hydroxy-1,1-diphenyl-3-trimethylsilyloxybutan-2-yl)benzenesulfonamide (PubChem CID 139840631) has the molecular formula C25H29Cl2NO4SSi and a molecular weight of 538.57 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-hydroxy-1,1-diphenyl-3-trimethylsilyloxybutan-2-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(1-hydroxy-1,1-diphenyl-3-trimethylsilyloxybutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 139840631 |
| Molecular Formula | C25H29Cl2NO4SSi |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 2,5-dichloro-N-(1-hydroxy-1,1-diphenyl-3-trimethylsilyloxybutan-2-yl)benzenesulfonamide |
| SMILES | CC(O[Si](C)(C)C)C(NS(=O)(=O)c1cc(Cl)ccc1Cl)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29Cl2NO4SSi/c1-18(32-34(2,3)4)24(28-33(30,31)23-17-21(26)15-16-22(23)27)25(29,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-18,24,28-29H,1-4H3 |
| InChIKey | YRRKRZBSMYJZQW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|