C23H38O2S — CID 101154775
S-[2,4,6-tri(propan-2-yl)phenyl] (2R,3R)-3-hydroxy-2,4,4-trimethylpentanethioate (PubChem CID 101154775) has the molecular formula C23H38O2S and a molecular weight of 378.62 g/mol. Its IUPAC name is S-[2,4,6-tri(propan-2-yl)phenyl] (2R,3R)-3-hydroxy-2,4,4-trimethylpentanethioate.
| Compound Name | S-[2,4,6-tri(propan-2-yl)phenyl] (2R,3R)-3-hydroxy-2,4,4-trimethylpentanethioate |
|---|---|
| PubChem CID | 101154775 |
| Molecular Formula | C23H38O2S |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | S-[2,4,6-tri(propan-2-yl)phenyl] (2R,3R)-3-hydroxy-2,4,4-trimethylpentanethioate |
| SMILES | CC(C)c1cc(C(C)C)c(SC(=O)[C@H](C)[C@@H](O)C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C23H38O2S/c1-13(2)17-11-18(14(3)4)20(19(12-17)15(5)6)26-22(25)16(7)21(24)23(8,9)10/h11-16,21,24H,1-10H3/t16-,21-/m1/s1 |
| InChIKey | CNSJZRNUHSCGAX-IIBYNOLFSA-N |
| XLogP | 6.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|