C20H30O2S — CID 85241413
3-[2,4,6-tri(propan-2-yl)phenyl]sulfinylpent-3-en-2-one (PubChem CID 85241413) has the molecular formula C20H30O2S and a molecular weight of 334.53 g/mol. Its IUPAC name is 3-[2,4,6-tri(propan-2-yl)phenyl]sulfinylpent-3-en-2-one.
| Compound Name | 3-[2,4,6-tri(propan-2-yl)phenyl]sulfinylpent-3-en-2-one |
|---|---|
| PubChem CID | 85241413 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-[2,4,6-tri(propan-2-yl)phenyl]sulfinylpent-3-en-2-one |
| SMILES | CC=C(C(C)=O)S(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C20H30O2S/c1-9-19(15(8)21)23(22)20-17(13(4)5)10-16(12(2)3)11-18(20)14(6)7/h9-14H,1-8H3 |
| InChIKey | PVYVSXDGIXVFHP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|