About (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide
(NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide (PubChem CID 46177609) has the molecular formula C22H29NOS
and a molecular weight of 355.55 g/mol. Its IUPAC name is (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide.
Molecular Properties
| Compound Name | (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide |
| PubChem CID | 46177609 |
| Molecular Formula | C22H29NOS |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide |
| SMILES | CC(C)c1cc(C(C)C)c([S@@](=O)/N=C/c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C22H29NOS/c1-15(2)19-12-20(16(3)4)22(21(13-19)17(5)6)25(24)23-14-18-10-8-7-9-11-18/h7-17H,1-6H3/b23-14+/t25-/m1/s1 |
| InChIKey | USRVPJYKJNQPQU-AQIZGWBQSA-N |
| XLogP | 6.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide?
The IUPAC name of (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide (CID 46177609) is (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide.
What is the SMILES notation for (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide?
The canonical SMILES for (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide is CC(C)c1cc(C(C)C)c([S@@](=O)/N=C/c2ccccc2)c(C(C)C)c1.
What is the InChIKey of (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide?
The InChIKey is USRVPJYKJNQPQU-AQIZGWBQSA-N. The full InChI is InChI=1S/C22H29NOS/c1-15(2)19-12-20(16(3)4)22(21(13-19)17(5)6)25(24)23-14-18-10-8-7-9-11-18/h7-17H,1-6H3/b23-14+/t25-/m1/s1.
What are the key properties of (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide?
(NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide has a molecular weight of 355.55 g/mol, XLogP of 6.20, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (NE,R)-N-benzylidene-2,4,6-tri(propan-2-yl)benzenesulfinamide is sourced from PubChem (CID 46177609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).