C21H28FNOS — CID 135269427
N-(2-fluorophenyl)-2,4,6-tri(propan-2-yl)benzenesulfinamide (PubChem CID 135269427) has the molecular formula C21H28FNOS and a molecular weight of 361.53 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2,4,6-tri(propan-2-yl)benzenesulfinamide.
| Compound Name | N-(2-fluorophenyl)-2,4,6-tri(propan-2-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 135269427 |
| Molecular Formula | C21H28FNOS |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N-(2-fluorophenyl)-2,4,6-tri(propan-2-yl)benzenesulfinamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)Nc2ccccc2F)c(C(C)C)c1 |
| InChI | InChI=1S/C21H28FNOS/c1-13(2)16-11-17(14(3)4)21(18(12-16)15(5)6)25(24)23-20-10-8-7-9-19(20)22/h7-15,23H,1-6H3 |
| InChIKey | FKCBGKCBPVWRMJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |