C21H30N2 — CID 57083210
1-[2,4-di(propan-2-yl)phenyl]-2-(2-propan-2-ylphenyl)hydrazine (PubChem CID 57083210) has the molecular formula C21H30N2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)phenyl]-2-(2-propan-2-ylphenyl)hydrazine.
| Compound Name | 1-[2,4-di(propan-2-yl)phenyl]-2-(2-propan-2-ylphenyl)hydrazine |
|---|---|
| PubChem CID | 57083210 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)phenyl]-2-(2-propan-2-ylphenyl)hydrazine |
| SMILES | CC(C)c1ccc(NNc2ccccc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C21H30N2/c1-14(2)17-11-12-21(19(13-17)16(5)6)23-22-20-10-8-7-9-18(20)15(3)4/h7-16,22-23H,1-6H3 |
| InChIKey | ZCFZKIDGIKOJRZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|