C17H29N — CID 43693580
N-pentan-3-yl-2,4-di(propan-2-yl)aniline (PubChem CID 43693580) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is N-pentan-3-yl-2,4-di(propan-2-yl)aniline.
| Compound Name | N-pentan-3-yl-2,4-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 43693580 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-pentan-3-yl-2,4-di(propan-2-yl)aniline |
| SMILES | CCC(CC)Nc1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C17H29N/c1-7-15(8-2)18-17-10-9-14(12(3)4)11-16(17)13(5)6/h9-13,15,18H,7-8H2,1-6H3 |
| InChIKey | LZIVUFBPVVRQEC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |