C19H27NO — CID 63434581
N-[1-(furan-2-yl)propyl]-2,4-di(propan-2-yl)aniline (PubChem CID 63434581) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is N-[1-(furan-2-yl)propyl]-2,4-di(propan-2-yl)aniline.
| Compound Name | N-[1-(furan-2-yl)propyl]-2,4-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 63434581 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-[1-(furan-2-yl)propyl]-2,4-di(propan-2-yl)aniline |
| SMILES | CCC(Nc1ccc(C(C)C)cc1C(C)C)c1ccco1 |
| InChI | InChI=1S/C19H27NO/c1-6-17(19-8-7-11-21-19)20-18-10-9-15(13(2)3)12-16(18)14(4)5/h7-14,17,20H,6H2,1-5H3 |
| InChIKey | WOZICCGFFHDCRA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |