About N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline
N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline (PubChem CID 63434709) has the molecular formula C18H24BrNS
and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline |
| PubChem CID | 63434709 |
| Molecular Formula | C18H24BrNS |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline |
| SMILES | CC(C)c1ccc(NC(C)c2ccc(Br)s2)c(C(C)C)c1 |
| InChI | InChI=1S/C18H24BrNS/c1-11(2)14-6-7-16(15(10-14)12(3)4)20-13(5)17-8-9-18(19)21-17/h6-13,20H,1-5H3 |
| InChIKey | QTRLKFDGKJHUIW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline?
The IUPAC name of N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline (CID 63434709) is N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline.
What is the SMILES notation for N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline?
The canonical SMILES for N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline is CC(C)c1ccc(NC(C)c2ccc(Br)s2)c(C(C)C)c1.
What is the InChIKey of N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline?
The InChIKey is QTRLKFDGKJHUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24BrNS/c1-11(2)14-6-7-16(15(10-14)12(3)4)20-13(5)17-8-9-18(19)21-17/h6-13,20H,1-5H3.
What are the key properties of N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline?
N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline has a molecular weight of 366.37 g/mol, XLogP of 6.93, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-bromothiophen-2-yl)ethyl]-2,4-di(propan-2-yl)aniline is sourced from PubChem (CID 63434709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).