C15H17BrN2OS — CID 61001055
4-[1-(5-bromothiophen-2-yl)ethylamino]-N,3-dimethylbenzamide (PubChem CID 61001055) has the molecular formula C15H17BrN2OS and a molecular weight of 353.29 g/mol. Its IUPAC name is 4-[1-(5-bromothiophen-2-yl)ethylamino]-N,3-dimethylbenzamide.
| Compound Name | 4-[1-(5-bromothiophen-2-yl)ethylamino]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 61001055 |
| Molecular Formula | C15H17BrN2OS |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 4-[1-(5-bromothiophen-2-yl)ethylamino]-N,3-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(NC(C)c2ccc(Br)s2)c(C)c1 |
| InChI | InChI=1S/C15H17BrN2OS/c1-9-8-11(15(19)17-3)4-5-12(9)18-10(2)13-6-7-14(16)20-13/h4-8,10,18H,1-3H3,(H,17,19) |
| InChIKey | FJTGINXGZMDEPO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |