C14H16BrNOS — CID 106953509
4-[1-(5-bromothiophen-2-yl)ethylamino]-2,5-dimethylphenol (PubChem CID 106953509) has the molecular formula C14H16BrNOS and a molecular weight of 326.26 g/mol. Its IUPAC name is 4-[1-(5-bromothiophen-2-yl)ethylamino]-2,5-dimethylphenol.
| Compound Name | 4-[1-(5-bromothiophen-2-yl)ethylamino]-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106953509 |
| Molecular Formula | C14H16BrNOS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 4-[1-(5-bromothiophen-2-yl)ethylamino]-2,5-dimethylphenol |
| SMILES | Cc1cc(NC(C)c2ccc(Br)s2)c(C)cc1O |
| InChI | InChI=1S/C14H16BrNOS/c1-8-7-12(17)9(2)6-11(8)16-10(3)13-4-5-14(15)18-13/h4-7,10,16-17H,1-3H3 |
| InChIKey | TVXOSBAOZPSUSU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|