C22H35NO3S — CID 141499809
butyl 2-(diethylcarbamoylsulfanyl)-3,5-di(propan-2-yl)benzoate (PubChem CID 141499809) has the molecular formula C22H35NO3S and a molecular weight of 393.59 g/mol. Its IUPAC name is butyl 2-(diethylcarbamoylsulfanyl)-3,5-di(propan-2-yl)benzoate.
| Compound Name | butyl 2-(diethylcarbamoylsulfanyl)-3,5-di(propan-2-yl)benzoate |
|---|---|
| PubChem CID | 141499809 |
| Molecular Formula | C22H35NO3S |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | butyl 2-(diethylcarbamoylsulfanyl)-3,5-di(propan-2-yl)benzoate |
| SMILES | CCCCOC(=O)c1cc(C(C)C)cc(C(C)C)c1SC(=O)N(CC)CC |
| InChI | InChI=1S/C22H35NO3S/c1-8-11-12-26-21(24)19-14-17(15(4)5)13-18(16(6)7)20(19)27-22(25)23(9-2)10-3/h13-16H,8-12H2,1-7H3 |
| InChIKey | ZVSZZQBPCYOUTH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|