C45H69AgF5S3 — CID 159312206
difluorosilver;trifluoro-[2,4,6-tri(propan-2-yl)phenyl]-λ4-sulfane;1,3,5-tri(propan-2-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]disulfanyl]benzene (PubChem CID 159312206) has the molecular formula C45H69AgF5S3 and a molecular weight of 909.11 g/mol. Its IUPAC name is difluorosilver;trifluoro-[2,4,6-tri(propan-2-yl)phenyl]-λ4-sulfane;1,3,5-tri(propan-2-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]disulfanyl]benzene.
| Compound Name | difluorosilver;trifluoro-[2,4,6-tri(propan-2-yl)phenyl]-λ4-sulfane;1,3,5-tri(propan-2-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]disulfanyl]benzene |
|---|---|
| PubChem CID | 159312206 |
| Molecular Formula | C45H69AgF5S3 |
| Molecular Weight | 909.11 g/mol |
| Exact Mass | 907.35 |
| IUPAC Name | difluorosilver;trifluoro-[2,4,6-tri(propan-2-yl)phenyl]-λ4-sulfane;1,3,5-tri(propan-2-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]disulfanyl]benzene |
| SMILES | CC(C)c1cc(C(C)C)c(S(F)(F)F)c(C(C)C)c1.CC(C)c1cc(C(C)C)c(SSc2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1.F[Ag]F |
| InChI | InChI=1S/C30H46S2.C15H23F3S.Ag.2FH/c1-17(2)23-13-25(19(5)6)29(26(14-23)20(7)8)31-32-30-27(21(9)10)15-24(18(3)4)16-28(30)22(11)12;1-9(2)12-7-13(10(3)4)15(19(16,17)18)14(8-12)11(5)6;;;/h13-22H,1-12H3;7-11H,1-6H3;;2*1H/q;;+2;;/p-2 |
| InChIKey | LCROEEZIDBTSDQ-UHFFFAOYSA-L |
| XLogP | 18.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.11 |
| LogP ≤ 5 | 18.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|