C45H59F3O3S2 — CID 87611726
2,4,6-tri(propan-2-yl)benzenesulfonate;tris[2-(1-fluorobutyl)phenyl]sulfanium (PubChem CID 87611726) has the molecular formula C45H59F3O3S2 and a molecular weight of 769.09 g/mol. Its IUPAC name is 2,4,6-tri(propan-2-yl)benzenesulfonate;tris[2-(1-fluorobutyl)phenyl]sulfanium.
| Compound Name | 2,4,6-tri(propan-2-yl)benzenesulfonate;tris[2-(1-fluorobutyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 87611726 |
| Molecular Formula | C45H59F3O3S2 |
| Molecular Weight | 769.09 g/mol |
| Exact Mass | 768.39 |
| IUPAC Name | 2,4,6-tri(propan-2-yl)benzenesulfonate;tris[2-(1-fluorobutyl)phenyl]sulfanium |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)[O-])c(C(C)C)c1.CCCC(F)c1ccccc1[S+](c1ccccc1C(F)CCC)c1ccccc1C(F)CCC |
| InChI | InChI=1S/C30H36F3S.C15H24O3S/c1-4-13-25(31)22-16-7-10-19-28(22)34(29-20-11-8-17-23(29)26(32)14-5-2)30-21-12-9-18-24(30)27(33)15-6-3;1-9(2)12-7-13(10(3)4)15(19(16,17)18)14(8-12)11(5)6/h7-12,16-21,25-27H,4-6,13-15H2,1-3H3;7-11H,1-6H3,(H,16,17,18)/q+1;/p-1 |
| InChIKey | XBNIGVDHUKINPU-UHFFFAOYSA-M |
| XLogP | 14.18 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.09 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|