C14H14O4 — CID 90880390
methyl 2-methoxy-4-oxo-6-phenylhexa-2,5-dienoate (PubChem CID 90880390) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is methyl 2-methoxy-4-oxo-6-phenylhexa-2,5-dienoate.
| Compound Name | methyl 2-methoxy-4-oxo-6-phenylhexa-2,5-dienoate |
|---|---|
| PubChem CID | 90880390 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | methyl 2-methoxy-4-oxo-6-phenylhexa-2,5-dienoate |
| SMILES | COC(=O)C(=CC(=O)C=Cc1ccccc1)OC |
| InChI | InChI=1S/C14H14O4/c1-17-13(14(16)18-2)10-12(15)9-8-11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | ZTNWJRLQUZKEDS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|