C13H16FNO6S — CID 122067948
2-[(3-fluoro-5-methoxycarbonylphenyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 122067948) has the molecular formula C13H16FNO6S and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[(3-fluoro-5-methoxycarbonylphenyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | 2-[(3-fluoro-5-methoxycarbonylphenyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122067948 |
| Molecular Formula | C13H16FNO6S |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-[(3-fluoro-5-methoxycarbonylphenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | COC(=O)c1cc(F)cc(S(=O)(=O)NC(C(=O)O)C(C)C)c1 |
| InChI | InChI=1S/C13H16FNO6S/c1-7(2)11(12(16)17)15-22(19,20)10-5-8(13(18)21-3)4-9(14)6-10/h4-7,11,15H,1-3H3,(H,16,17) |
| InChIKey | JPGDTBOHIGMTAP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |