C16H23NO7S — CID 122067804
2-[[3-ethoxycarbonyl-5-(methoxymethyl)phenyl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 122067804) has the molecular formula C16H23NO7S and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-[[3-ethoxycarbonyl-5-(methoxymethyl)phenyl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | 2-[[3-ethoxycarbonyl-5-(methoxymethyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122067804 |
| Molecular Formula | C16H23NO7S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[[3-ethoxycarbonyl-5-(methoxymethyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CCOC(=O)c1cc(COC)cc(S(=O)(=O)NC(C(=O)O)C(C)C)c1 |
| InChI | InChI=1S/C16H23NO7S/c1-5-24-16(20)12-6-11(9-23-4)7-13(8-12)25(21,22)17-14(10(2)3)15(18)19/h6-8,10,14,17H,5,9H2,1-4H3,(H,18,19) |
| InChIKey | WINCCIRWYCELRI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |