C11H15BrN4O2S2 — CID 106085272
2-bromo-N-[2-(1H-imidazol-2-yl)ethyl]-5-(methylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106085272) has the molecular formula C11H15BrN4O2S2 and a molecular weight of 379.31 g/mol. Its IUPAC name is 2-bromo-N-[2-(1H-imidazol-2-yl)ethyl]-5-(methylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-N-[2-(1H-imidazol-2-yl)ethyl]-5-(methylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106085272 |
| Molecular Formula | C11H15BrN4O2S2 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 2-bromo-N-[2-(1H-imidazol-2-yl)ethyl]-5-(methylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCCc2ncc[nH]2)c(Br)s1 |
| InChI | InChI=1S/C11H15BrN4O2S2/c1-13-7-8-6-9(11(12)19-8)20(17,18)16-3-2-10-14-4-5-15-10/h4-6,13,16H,2-3,7H2,1H3,(H,14,15) |
| InChIKey | FFJCVZFJBXEUJV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |