C12H17BrN4O2S2 — CID 106106635
2-bromo-5-(methylaminomethyl)-N-[2-(1-methylpyrazol-3-yl)ethyl]thiophene-3-sulfonamide (PubChem CID 106106635) has the molecular formula C12H17BrN4O2S2 and a molecular weight of 393.33 g/mol. Its IUPAC name is 2-bromo-5-(methylaminomethyl)-N-[2-(1-methylpyrazol-3-yl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(methylaminomethyl)-N-[2-(1-methylpyrazol-3-yl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106106635 |
| Molecular Formula | C12H17BrN4O2S2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2-bromo-5-(methylaminomethyl)-N-[2-(1-methylpyrazol-3-yl)ethyl]thiophene-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCCc2ccn(C)n2)c(Br)s1 |
| InChI | InChI=1S/C12H17BrN4O2S2/c1-14-8-10-7-11(12(13)20-10)21(18,19)15-5-3-9-4-6-17(2)16-9/h4,6-7,14-15H,3,5,8H2,1-2H3 |
| InChIKey | VOTBJWBPKTXUEU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |