C9H10BrN3O3S2 — CID 114134158
2-bromo-5-(hydroxymethyl)-N-(1-methylpyrazol-3-yl)thiophene-3-sulfonamide (PubChem CID 114134158) has the molecular formula C9H10BrN3O3S2 and a molecular weight of 352.24 g/mol. Its IUPAC name is 2-bromo-5-(hydroxymethyl)-N-(1-methylpyrazol-3-yl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(hydroxymethyl)-N-(1-methylpyrazol-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114134158 |
| Molecular Formula | C9H10BrN3O3S2 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 2-bromo-5-(hydroxymethyl)-N-(1-methylpyrazol-3-yl)thiophene-3-sulfonamide |
| SMILES | Cn1ccc(NS(=O)(=O)c2cc(CO)sc2Br)n1 |
| InChI | InChI=1S/C9H10BrN3O3S2/c1-13-3-2-8(11-13)12-18(15,16)7-4-6(5-14)17-9(7)10/h2-4,14H,5H2,1H3,(H,11,12) |
| InChIKey | AEYYGFYYZIPWBP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |