C15H16BrNO6S — CID 100814264
methyl 2-[2-bromo-4-[2-(furan-2-yl)ethylsulfamoyl]phenoxy]acetate (PubChem CID 100814264) has the molecular formula C15H16BrNO6S and a molecular weight of 418.27 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[2-(furan-2-yl)ethylsulfamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[2-(furan-2-yl)ethylsulfamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 100814264 |
| Molecular Formula | C15H16BrNO6S |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | methyl 2-[2-bromo-4-[2-(furan-2-yl)ethylsulfamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)NCCc2ccco2)cc1Br |
| InChI | InChI=1S/C15H16BrNO6S/c1-21-15(18)10-23-14-5-4-12(9-13(14)16)24(19,20)17-7-6-11-3-2-8-22-11/h2-5,8-9,17H,6-7,10H2,1H3 |
| InChIKey | WCCWFSNISFOPFH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |