C14H20N2O4 — CID 62586256
2-(3-hydroxypropylamino)-2-(2,4,6-trimethoxyphenyl)acetonitrile (PubChem CID 62586256) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-(3-hydroxypropylamino)-2-(2,4,6-trimethoxyphenyl)acetonitrile.
| Compound Name | 2-(3-hydroxypropylamino)-2-(2,4,6-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 62586256 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-(3-hydroxypropylamino)-2-(2,4,6-trimethoxyphenyl)acetonitrile |
| SMILES | COc1cc(OC)c(C(C#N)NCCCO)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-18-10-7-12(19-2)14(13(8-10)20-3)11(9-15)16-5-4-6-17/h7-8,11,16-17H,4-6H2,1-3H3 |
| InChIKey | TXTDBNYHZMEWCG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|