C14H24O — CID 145162250
ethane;1-ethenoxy-2,4-dimethylbenzene (PubChem CID 145162250) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is ethane;1-ethenoxy-2,4-dimethylbenzene.
| Compound Name | ethane;1-ethenoxy-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 145162250 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | ethane;1-ethenoxy-2,4-dimethylbenzene |
| SMILES | C=COc1ccc(C)cc1C.CC.CC |
| InChI | InChI=1S/C10H12O.2C2H6/c1-4-11-10-6-5-8(2)7-9(10)3;2*1-2/h4-7H,1H2,2-3H3;2*1-2H3 |
| InChIKey | RVOYGJANLDEDRM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|