C14H21NO — CID 169209283
(1E)-2-(2,4-dimethylphenoxy)buta-1,3-dien-1-amine;ethane (PubChem CID 169209283) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (1E)-2-(2,4-dimethylphenoxy)buta-1,3-dien-1-amine;ethane.
| Compound Name | (1E)-2-(2,4-dimethylphenoxy)buta-1,3-dien-1-amine;ethane |
|---|---|
| PubChem CID | 169209283 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (1E)-2-(2,4-dimethylphenoxy)buta-1,3-dien-1-amine;ethane |
| SMILES | C=C/C(=C\N)Oc1ccc(C)cc1C.CC |
| InChI | InChI=1S/C12H15NO.C2H6/c1-4-11(8-13)14-12-6-5-9(2)7-10(12)3;1-2/h4-8H,1,13H2,2-3H3;1-2H3/b11-8+; |
| InChIKey | CNQCWGPPMADQJR-YGCVIUNWSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|