C11H11FO — CID 167112017
1-buta-1,3-dien-2-yloxy-4-fluoro-2-methylbenzene (PubChem CID 167112017) has the molecular formula C11H11FO and a molecular weight of 178.21 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yloxy-4-fluoro-2-methylbenzene.
| Compound Name | 1-buta-1,3-dien-2-yloxy-4-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 167112017 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1-buta-1,3-dien-2-yloxy-4-fluoro-2-methylbenzene |
| SMILES | C=CC(=C)Oc1ccc(F)cc1C |
| InChI | InChI=1S/C11H11FO/c1-4-9(3)13-11-6-5-10(12)7-8(11)2/h4-7H,1,3H2,2H3 |
| InChIKey | XYXYMXJMEZSVLJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|