C11H12O — CID 123651418
1-buta-1,3-dien-2-yloxy-2-methylbenzene (PubChem CID 123651418) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yloxy-2-methylbenzene.
| Compound Name | 1-buta-1,3-dien-2-yloxy-2-methylbenzene |
|---|---|
| PubChem CID | 123651418 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 1-buta-1,3-dien-2-yloxy-2-methylbenzene |
| SMILES | C=CC(=C)Oc1ccccc1C |
| InChI | InChI=1S/C11H12O/c1-4-10(3)12-11-8-6-5-7-9(11)2/h4-8H,1,3H2,2H3 |
| InChIKey | UCKFKOWXMGKCPZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|