C21H24O — CID 165085463
1-buta-1,3-dien-2-yloxy-2-[(4-tert-butylphenyl)methyl]benzene (PubChem CID 165085463) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yloxy-2-[(4-tert-butylphenyl)methyl]benzene.
| Compound Name | 1-buta-1,3-dien-2-yloxy-2-[(4-tert-butylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 165085463 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-buta-1,3-dien-2-yloxy-2-[(4-tert-butylphenyl)methyl]benzene |
| SMILES | C=CC(=C)Oc1ccccc1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H24O/c1-6-16(2)22-20-10-8-7-9-18(20)15-17-11-13-19(14-12-17)21(3,4)5/h6-14H,1-2,15H2,3-5H3 |
| InChIKey | VVGDTKHXFSVHHV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|