C11H11FO2 — CID 123425580
4-buta-1,3-dien-2-yloxy-2-fluoro-1-methoxybenzene (PubChem CID 123425580) has the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yloxy-2-fluoro-1-methoxybenzene.
| Compound Name | 4-buta-1,3-dien-2-yloxy-2-fluoro-1-methoxybenzene |
|---|---|
| PubChem CID | 123425580 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 4-buta-1,3-dien-2-yloxy-2-fluoro-1-methoxybenzene |
| SMILES | C=CC(=C)Oc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C11H11FO2/c1-4-8(2)14-9-5-6-11(13-3)10(12)7-9/h4-7H,1-2H2,3H3 |
| InChIKey | HHMXKSFSDMOZOR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|