C18H15N3O3 — CID 138481562
[4-[[4-(prop-2-enoylamino)phenyl]diazenyl]phenyl] prop-2-enoate (PubChem CID 138481562) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is [4-[[4-(prop-2-enoylamino)phenyl]diazenyl]phenyl] prop-2-enoate.
| Compound Name | [4-[[4-(prop-2-enoylamino)phenyl]diazenyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 138481562 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | [4-[[4-(prop-2-enoylamino)phenyl]diazenyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Nc1ccc(/N=N/c2ccc(OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-3-17(22)19-13-5-7-14(8-6-13)20-21-15-9-11-16(12-10-15)24-18(23)4-2/h3-12H,1-2H2,(H,19,22)/b21-20+ |
| InChIKey | CBYXFFPYROHDFB-QZQOTICOSA-N |
| XLogP | 4.32 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|