C15H14O2 — CID 164546423
(2-cyclopenta-2,4-dien-1-yl-6-methylphenyl) prop-2-enoate (PubChem CID 164546423) has the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. Its IUPAC name is (2-cyclopenta-2,4-dien-1-yl-6-methylphenyl) prop-2-enoate.
| Compound Name | (2-cyclopenta-2,4-dien-1-yl-6-methylphenyl) prop-2-enoate |
|---|---|
| PubChem CID | 164546423 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2-cyclopenta-2,4-dien-1-yl-6-methylphenyl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C)cccc1C1C=CC=C1 |
| InChI | InChI=1S/C15H14O2/c1-3-14(16)17-15-11(2)7-6-10-13(15)12-8-4-5-9-12/h3-10,12H,1H2,2H3 |
| InChIKey | AYBNDUANTWYWMN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|