C17H16O2 — CID 174664238
[4-(2,3-dimethylphenyl)phenyl] prop-2-enoate (PubChem CID 174664238) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is [4-(2,3-dimethylphenyl)phenyl] prop-2-enoate.
| Compound Name | [4-(2,3-dimethylphenyl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174664238 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | [4-(2,3-dimethylphenyl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C17H16O2/c1-4-17(18)19-15-10-8-14(9-11-15)16-7-5-6-12(2)13(16)3/h4-11H,1H2,2-3H3 |
| InChIKey | PQNGXACHFWYTIA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|