C22H22Br4O2 — CID 22992613
[2,6-dibromo-4-[2-(3,5-dibromo-4-propylphenyl)propan-2-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 22992613) has the molecular formula C22H22Br4O2 and a molecular weight of 638.03 g/mol. Its IUPAC name is [2,6-dibromo-4-[2-(3,5-dibromo-4-propylphenyl)propan-2-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-propylphenyl)propan-2-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22992613 |
| Molecular Formula | C22H22Br4O2 |
| Molecular Weight | 638.03 g/mol |
| Exact Mass | 633.84 |
| IUPAC Name | [2,6-dibromo-4-[2-(3,5-dibromo-4-propylphenyl)propan-2-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(Br)cc(C(C)(C)c2cc(Br)c(CCC)c(Br)c2)cc1Br |
| InChI | InChI=1S/C22H22Br4O2/c1-6-7-15-16(23)8-13(9-17(15)24)22(4,5)14-10-18(25)20(19(26)11-14)28-21(27)12(2)3/h8-11H,2,6-7H2,1,3-5H3 |
| InChIKey | XXDBLQLRJCOSAM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.03 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|