C20H7Br5O5 — CID 156905114
1',2',4',5',7'-pentabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 156905114) has the molecular formula C20H7Br5O5 and a molecular weight of 726.79 g/mol. Its IUPAC name is 1',2',4',5',7'-pentabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 1',2',4',5',7'-pentabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 156905114 |
| Molecular Formula | C20H7Br5O5 |
| Molecular Weight | 726.79 g/mol |
| Exact Mass | 721.62 |
| IUPAC Name | 1',2',4',5',7'-pentabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccccc31)c1cc(Br)c(O)c(Br)c1Oc1c(Br)c(O)c(Br)c(Br)c12 |
| InChI | InChI=1S/C20H7Br5O5/c21-9-5-8-17(13(24)15(9)26)29-18-10(11(22)12(23)16(27)14(18)25)20(8)7-4-2-1-3-6(7)19(28)30-20/h1-5,26-27H |
| InChIKey | MUPMOUCTIGXXMF-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.79 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|