C20H10Br4O5 — CID 69351282
3',4,5',7'-tetrabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-4H-xanthene]-1-one (PubChem CID 69351282) has the molecular formula C20H10Br4O5 and a molecular weight of 649.91 g/mol. Its IUPAC name is 3',4,5',7'-tetrabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-4H-xanthene]-1-one.
| Compound Name | 3',4,5',7'-tetrabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-4H-xanthene]-1-one |
|---|---|
| PubChem CID | 69351282 |
| Molecular Formula | C20H10Br4O5 |
| Molecular Weight | 649.91 g/mol |
| Exact Mass | 645.73 |
| IUPAC Name | 3',4,5',7'-tetrabromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-4H-xanthene]-1-one |
| SMILES | O=C1OC2(C3=C(CC(O)(Br)C=C3)Oc3c2cc(Br)c(O)c3Br)c2c(Br)cccc21 |
| InChI | InChI=1S/C20H10Br4O5/c21-11-3-1-2-8-14(11)20(29-18(8)26)9-4-5-19(24,27)7-13(9)28-17-10(20)6-12(22)16(25)15(17)23/h1-6,25,27H,7H2 |
| InChIKey | IKOOXNLMGBCRJR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.91 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|