C26H24O5 — CID 69249791
3',6'-dihydroxy-2',7'-dipropylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 69249791) has the molecular formula C26H24O5 and a molecular weight of 416.47 g/mol. Its IUPAC name is 3',6'-dihydroxy-2',7'-dipropylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-2',7'-dipropylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 69249791 |
| Molecular Formula | C26H24O5 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 3',6'-dihydroxy-2',7'-dipropylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCc1cc2c(cc1O)Oc1cc(O)c(CCC)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C26H24O5/c1-3-7-15-11-19-23(13-21(15)27)30-24-14-22(28)16(8-4-2)12-20(24)26(19)18-10-6-5-9-17(18)25(29)31-26/h5-6,9-14,27-28H,3-4,7-8H2,1-2H3 |
| InChIKey | KPIUPRXGNRGLHI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |