About 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one
3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one (PubChem CID 14876464) has the molecular formula C24H14O5
and a molecular weight of 382.37 g/mol. Its IUPAC name is 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one.
Molecular Properties
| Compound Name | 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one |
| PubChem CID | 14876464 |
| Molecular Formula | C24H14O5 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3c2ccc2cc(O)ccc32)c2ccccc21 |
| InChI | InChI=1S/C24H14O5/c25-14-6-8-16-13(11-14)5-9-20-22(16)28-21-12-15(26)7-10-19(21)24(20)18-4-2-1-3-17(18)23(27)29-24/h1-12,25-26H |
| InChIKey | WFOTVGYJMFZMTD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one?
The IUPAC name of 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one (CID 14876464) is 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one.
What is the SMILES notation for 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one?
The canonical SMILES for 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one is O=C1OC2(c3ccc(O)cc3Oc3c2ccc2cc(O)ccc32)c2ccccc21.
What is the InChIKey of 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one?
The InChIKey is WFOTVGYJMFZMTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14O5/c25-14-6-8-16-13(11-14)5-9-20-22(16)28-21-12-15(26)7-10-19(21)24(20)18-4-2-1-3-17(18)23(27)29-24/h1-12,25-26H.
What are the key properties of 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one?
3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one has a molecular weight of 382.37 g/mol, XLogP of 4.82, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3',10'-dihydroxyspiro[2-benzofuran-3,7'-benzo[c]xanthene]-1-one is sourced from PubChem (CID 14876464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).