C29H27BN2O7S — CID 147753934
CID 147753934 (PubChem CID 147753934) has the molecular formula C29H27BN2O7S and a molecular weight of 558.42 g/mol.
| Compound Name | CID 147753934 |
|---|---|
| PubChem CID | 147753934 |
| Molecular Formula | C29H27BN2O7S |
| Molecular Weight | 558.42 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CC(NC(=S)Nc2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(O)ccc32)[C@@H](COC(C)C)O1 |
| InChI | InChI=1S/C29H27BN2O7S/c1-14(2)36-13-25-22(12-26(30)38-25)32-28(40)31-15-3-6-19-18(9-15)27(35)39-29(19)20-7-4-16(33)10-23(20)37-24-11-17(34)5-8-21(24)29/h3-11,14,22,25-26,33-34H,12-13H2,1-2H3,(H2,31,32,40)/t22?,25-,26-/m1/s1 |
| InChIKey | BUMNYMBIFMYCHE-FLZRTACHSA-N |
| XLogP | 4.03 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|