C31H25NO7S3 — CID 146664530
4-(2,3-dihydroxyphenyl)sulfanylbutyl N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamodithioate (PubChem CID 146664530) has the molecular formula C31H25NO7S3 and a molecular weight of 619.74 g/mol. Its IUPAC name is 4-(2,3-dihydroxyphenyl)sulfanylbutyl N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamodithioate.
| Compound Name | 4-(2,3-dihydroxyphenyl)sulfanylbutyl N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamodithioate |
|---|---|
| PubChem CID | 146664530 |
| Molecular Formula | C31H25NO7S3 |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | 4-(2,3-dihydroxyphenyl)sulfanylbutyl N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamodithioate |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccc(NC(=S)SCCCCSc3cccc(O)c3O)cc21 |
| InChI | InChI=1S/C31H25NO7S3/c33-18-7-10-22-25(15-18)38-26-16-19(34)8-11-23(26)31(22)21-9-6-17(14-20(21)29(37)39-31)32-30(40)42-13-2-1-12-41-27-5-3-4-24(35)28(27)36/h3-11,14-16,33-36H,1-2,12-13H2,(H,32,40) |
| InChIKey | OMTIKKKGWXSLAG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|