C52H42N4O19P2 — CID 10796219
[6'-[bis[1-(2-nitrophenyl)ethoxy]phosphoryloxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] bis[1-(2-nitrophenyl)ethyl] phosphate (PubChem CID 10796219) has the molecular formula C52H42N4O19P2 and a molecular weight of 1088.87 g/mol. Its IUPAC name is [6'-[bis[1-(2-nitrophenyl)ethoxy]phosphoryloxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] bis[1-(2-nitrophenyl)ethyl] phosphate.
| Compound Name | [6'-[bis[1-(2-nitrophenyl)ethoxy]phosphoryloxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] bis[1-(2-nitrophenyl)ethyl] phosphate |
|---|---|
| PubChem CID | 10796219 |
| Molecular Formula | C52H42N4O19P2 |
| Molecular Weight | 1088.87 g/mol |
| Exact Mass | 1088.19 |
| IUPAC Name | [6'-[bis[1-(2-nitrophenyl)ethoxy]phosphoryloxy]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] bis[1-(2-nitrophenyl)ethyl] phosphate |
| SMILES | CC(OP(=O)(Oc1ccc2c(c1)Oc1cc(OP(=O)(OC(C)c3ccccc3[N+](=O)[O-])OC(C)c3ccccc3[N+](=O)[O-])ccc1C21OC(=O)c2ccccc21)OC(C)c1ccccc1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C52H42N4O19P2/c1-31(37-15-6-11-21-45(37)53(58)59)70-76(66,71-32(2)38-16-7-12-22-46(38)54(60)61)74-35-25-27-43-49(29-35)68-50-30-36(26-28-44(50)52(43)42-20-10-5-19-41(42)51(57)69-52)75-77(67,72-33(3)39-17-8-13-23-47(39)55(62)63)73-34(4)40-18-9-14-24-48(40)56(64)65/h5-34H,1-4H3 |
| InChIKey | KTZJIMBJJRDKRW-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 297.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1088.87 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|