C32H28BrN3O6 — CID 163590102
2-amino-3'-(4-bromobutoxy)-6'-[1-(2-nitrophenyl)ethoxy]spiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 163590102) has the molecular formula C32H28BrN3O6 and a molecular weight of 630.50 g/mol. Its IUPAC name is 2-amino-3'-(4-bromobutoxy)-6'-[1-(2-nitrophenyl)ethoxy]spiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-amino-3'-(4-bromobutoxy)-6'-[1-(2-nitrophenyl)ethoxy]spiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 163590102 |
| Molecular Formula | C32H28BrN3O6 |
| Molecular Weight | 630.50 g/mol |
| Exact Mass | 629.12 |
| IUPAC Name | 2-amino-3'-(4-bromobutoxy)-6'-[1-(2-nitrophenyl)ethoxy]spiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CC(Oc1ccc2c(c1)Oc1cc(OCCCCBr)ccc1C21c2ccccc2C(=O)N1N)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H28BrN3O6/c1-20(23-8-3-5-11-28(23)36(38)39)41-22-13-15-27-30(19-22)42-29-18-21(40-17-7-6-16-33)12-14-26(29)32(27)25-10-4-2-9-24(25)31(37)35(32)34/h2-5,8-15,18-20H,6-7,16-17,34H2,1H3 |
| InChIKey | GOUJZNFZGIZBHQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|