C29H31Br2NO8S — CID 137374154
diethyl 2-[3-[3-[1-[4-(2,5-dibromothiophen-3-yl)phenoxy]ethyl]-4-nitrophenoxy]propyl]-2-methylpropanedioate (PubChem CID 137374154) has the molecular formula C29H31Br2NO8S and a molecular weight of 713.44 g/mol. Its IUPAC name is diethyl 2-[3-[3-[1-[4-(2,5-dibromothiophen-3-yl)phenoxy]ethyl]-4-nitrophenoxy]propyl]-2-methylpropanedioate.
| Compound Name | diethyl 2-[3-[3-[1-[4-(2,5-dibromothiophen-3-yl)phenoxy]ethyl]-4-nitrophenoxy]propyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 137374154 |
| Molecular Formula | C29H31Br2NO8S |
| Molecular Weight | 713.44 g/mol |
| Exact Mass | 711.01 |
| IUPAC Name | diethyl 2-[3-[3-[1-[4-(2,5-dibromothiophen-3-yl)phenoxy]ethyl]-4-nitrophenoxy]propyl]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(CCCOc1ccc([N+](=O)[O-])c(C(C)Oc2ccc(-c3cc(Br)sc3Br)cc2)c1)C(=O)OCC |
| InChI | InChI=1S/C29H31Br2NO8S/c1-5-37-27(33)29(4,28(34)38-6-2)14-7-15-39-21-12-13-24(32(35)36)22(16-21)18(3)40-20-10-8-19(9-11-20)23-17-25(30)41-26(23)31/h8-13,16-18H,5-7,14-15H2,1-4H3 |
| InChIKey | DICOKPFTZHLPJY-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.44 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|