C34H46O5 — CID 134408709
(2E,3E)-4'-[(1Z)-buta-1,3-dienyl]-7-hexoxy-2-(2-hexoxyethylidene)-3'-methyl-3-propylidenespiro[chromene-4,5'-furan]-2'-one (PubChem CID 134408709) has the molecular formula C34H46O5 and a molecular weight of 534.74 g/mol. Its IUPAC name is (2E,3E)-4'-[(1Z)-buta-1,3-dienyl]-7-hexoxy-2-(2-hexoxyethylidene)-3'-methyl-3-propylidenespiro[chromene-4,5'-furan]-2'-one.
| Compound Name | (2E,3E)-4'-[(1Z)-buta-1,3-dienyl]-7-hexoxy-2-(2-hexoxyethylidene)-3'-methyl-3-propylidenespiro[chromene-4,5'-furan]-2'-one |
|---|---|
| PubChem CID | 134408709 |
| Molecular Formula | C34H46O5 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | (2E,3E)-4'-[(1Z)-buta-1,3-dienyl]-7-hexoxy-2-(2-hexoxyethylidene)-3'-methyl-3-propylidenespiro[chromene-4,5'-furan]-2'-one |
| SMILES | C=C/C=C\C1=C(C)C(=O)OC12C(=C/CC)/C(=C\COCCCCCC)Oc1cc(OCCCCCC)ccc12 |
| InChI | InChI=1S/C34H46O5/c1-6-10-13-15-22-36-24-21-31-29(17-9-4)34(28(18-12-8-3)26(5)33(35)39-34)30-20-19-27(25-32(30)38-31)37-23-16-14-11-7-2/h8,12,17-21,25H,3,6-7,9-11,13-16,22-24H2,1-2,4-5H3/b18-12-,29-17+,31-21+ |
| InChIKey | OHBSAUDAUDNILW-WDVKGXHSSA-N |
| XLogP | 8.67 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|