C34H20O5S6 — CID 153370359
O-[3-oxo-6'-(phenyldisulfanyl)carbothioyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl] (phenyldisulfanyl)methanethioate (PubChem CID 153370359) has the molecular formula C34H20O5S6 and a molecular weight of 700.93 g/mol. Its IUPAC name is O-[3-oxo-6'-(phenyldisulfanyl)carbothioyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl] (phenyldisulfanyl)methanethioate.
| Compound Name | O-[3-oxo-6'-(phenyldisulfanyl)carbothioyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl] (phenyldisulfanyl)methanethioate |
|---|---|
| PubChem CID | 153370359 |
| Molecular Formula | C34H20O5S6 |
| Molecular Weight | 700.93 g/mol |
| Exact Mass | 699.96 |
| IUPAC Name | O-[3-oxo-6'-(phenyldisulfanyl)carbothioyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl] (phenyldisulfanyl)methanethioate |
| SMILES | O=C1OC2(c3ccc(OC(=S)SSc4ccccc4)cc3Oc3cc(OC(=S)SSc4ccccc4)ccc32)c2ccccc21 |
| InChI | InChI=1S/C34H20O5S6/c35-31-25-13-7-8-14-26(25)34(39-31)27-17-15-21(36-32(40)44-42-23-9-3-1-4-10-23)19-29(27)38-30-20-22(16-18-28(30)34)37-33(41)45-43-24-11-5-2-6-12-24/h1-20H |
| InChIKey | GXPRKLZRUWEJCE-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.93 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|