C25H41N7O4 — CID 177240626
(2S)-5-[[amino(dimethylamino)methylidene]amino]-N-[1-[2-(methylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]-2-(4-oxopentanoylamino)pentanamide (PubChem CID 177240626) has the molecular formula C25H41N7O4 and a molecular weight of 503.65 g/mol. Its IUPAC name is (2S)-5-[[amino(dimethylamino)methylidene]amino]-N-[1-[2-(methylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]-2-(4-oxopentanoylamino)pentanamide.
| Compound Name | (2S)-5-[[amino(dimethylamino)methylidene]amino]-N-[1-[2-(methylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]-2-(4-oxopentanoylamino)pentanamide |
|---|---|
| PubChem CID | 177240626 |
| Molecular Formula | C25H41N7O4 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.32 |
| IUPAC Name | (2S)-5-[[amino(dimethylamino)methylidene]amino]-N-[1-[2-(methylamino)ethylamino]-1-oxo-3-phenylpropan-2-yl]-2-(4-oxopentanoylamino)pentanamide |
| SMILES | CNCCNC(=O)C(Cc1ccccc1)NC(=O)[C@H](CCC/N=C(\N)N(C)C)NC(=O)CCC(C)=O |
| InChI | InChI=1S/C25H41N7O4/c1-18(33)12-13-22(34)30-20(11-8-14-29-25(26)32(3)4)24(36)31-21(23(35)28-16-15-27-2)17-19-9-6-5-7-10-19/h5-7,9-10,20-21,27H,8,11-17H2,1-4H3,(H2,26,29)(H,28,35)(H,30,34)(H,31,36)/t20-,21?/m0/s1 |
| InChIKey | DNWXQVSOUHUHDK-BGERDNNASA-N |
| XLogP | -0.44 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|