C34H44N8O6 — CID 11093566
(2S)-N-[(2S)-1-[(3-amino-3-oxopropyl)amino]-1-oxo-3-phenylpropan-2-yl]-2-[[2-[bis[(4-hydroxyphenyl)methyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 11093566) has the molecular formula C34H44N8O6 and a molecular weight of 660.78 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(3-amino-3-oxopropyl)amino]-1-oxo-3-phenylpropan-2-yl]-2-[[2-[bis[(4-hydroxyphenyl)methyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-N-[(2S)-1-[(3-amino-3-oxopropyl)amino]-1-oxo-3-phenylpropan-2-yl]-2-[[2-[bis[(4-hydroxyphenyl)methyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 11093566 |
| Molecular Formula | C34H44N8O6 |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.34 |
| IUPAC Name | (2S)-N-[(2S)-1-[(3-amino-3-oxopropyl)amino]-1-oxo-3-phenylpropan-2-yl]-2-[[2-[bis[(4-hydroxyphenyl)methyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)CCNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CN(Cc1ccc(O)cc1)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C34H44N8O6/c35-30(45)16-18-38-32(47)29(19-23-5-2-1-3-6-23)41-33(48)28(7-4-17-39-34(36)37)40-31(46)22-42(20-24-8-12-26(43)13-9-24)21-25-10-14-27(44)15-11-25/h1-3,5-6,8-15,28-29,43-44H,4,7,16-22H2,(H2,35,45)(H,38,47)(H,40,46)(H,41,48)(H4,36,37,39)/t28-,29-/m0/s1 |
| InChIKey | KRMGJZWCCMAUBZ-VMPREFPWSA-N |
| XLogP | 0.36 |
| TPSA | 238.49 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|